C12H30N4O5S — CID 23619153
2-[2-[cyclohexyl(propyl)amino]ethyl]guanidine;sulfuric acid;hydrate (PubChem CID 23619153) has the molecular formula C12H30N4O5S and a molecular weight of 342.46 g/mol. Its IUPAC name is 2-[2-[cyclohexyl(propyl)amino]ethyl]guanidine;sulfuric acid;hydrate.
| Compound Name | 2-[2-[cyclohexyl(propyl)amino]ethyl]guanidine;sulfuric acid;hydrate |
|---|---|
| PubChem CID | 23619153 |
| Molecular Formula | C12H30N4O5S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 2-[2-[cyclohexyl(propyl)amino]ethyl]guanidine;sulfuric acid;hydrate |
| SMILES | CCCN(CCN=C(N)N)C1CCCCC1.O.O=S(=O)(O)O |
| InChI | InChI=1S/C12H26N4.H2O4S.H2O/c1-2-9-16(10-8-15-12(13)14)11-6-4-3-5-7-11;1-5(2,3)4;/h11H,2-10H2,1H3,(H4,13,14,15);(H2,1,2,3,4);1H2 |
| InChIKey | ZQUDWGDESHEFIK-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 173.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|