C13H22N4O2S — CID 63316665
2-amino-N-[2-[cyclopentyl(methyl)amino]ethyl]pyridine-3-sulfonamide (PubChem CID 63316665) has the molecular formula C13H22N4O2S and a molecular weight of 298.41 g/mol. Its IUPAC name is 2-amino-N-[2-[cyclopentyl(methyl)amino]ethyl]pyridine-3-sulfonamide.
| Compound Name | 2-amino-N-[2-[cyclopentyl(methyl)amino]ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 63316665 |
| Molecular Formula | C13H22N4O2S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 2-amino-N-[2-[cyclopentyl(methyl)amino]ethyl]pyridine-3-sulfonamide |
| SMILES | CN(CCNS(=O)(=O)c1cccnc1N)C1CCCC1 |
| InChI | InChI=1S/C13H22N4O2S/c1-17(11-5-2-3-6-11)10-9-16-20(18,19)12-7-4-8-15-13(12)14/h4,7-8,11,16H,2-3,5-6,9-10H2,1H3,(H2,14,15) |
| InChIKey | SVLCAYYAJPFFTC-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |