C13H24N4O2S — CID 62156997
2-amino-N-[4-[methyl(propan-2-yl)amino]butyl]pyridine-3-sulfonamide (PubChem CID 62156997) has the molecular formula C13H24N4O2S and a molecular weight of 300.43 g/mol. Its IUPAC name is 2-amino-N-[4-[methyl(propan-2-yl)amino]butyl]pyridine-3-sulfonamide.
| Compound Name | 2-amino-N-[4-[methyl(propan-2-yl)amino]butyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62156997 |
| Molecular Formula | C13H24N4O2S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2-amino-N-[4-[methyl(propan-2-yl)amino]butyl]pyridine-3-sulfonamide |
| SMILES | CC(C)N(C)CCCCNS(=O)(=O)c1cccnc1N |
| InChI | InChI=1S/C13H24N4O2S/c1-11(2)17(3)10-5-4-9-16-20(18,19)12-7-6-8-15-13(12)14/h6-8,11,16H,4-5,9-10H2,1-3H3,(H2,14,15) |
| InChIKey | VOPFZZGWXFBKEW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|