C12H12F3N3O2 — CID 63320092
2-[4-(aminomethyl)-2-(trifluoromethyl)phenoxy]-N-(cyanomethyl)acetamide (PubChem CID 63320092) has the molecular formula C12H12F3N3O2 and a molecular weight of 287.24 g/mol. Its IUPAC name is 2-[4-(aminomethyl)-2-(trifluoromethyl)phenoxy]-N-(cyanomethyl)acetamide.
| Compound Name | 2-[4-(aminomethyl)-2-(trifluoromethyl)phenoxy]-N-(cyanomethyl)acetamide |
|---|---|
| PubChem CID | 63320092 |
| Molecular Formula | C12H12F3N3O2 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-[4-(aminomethyl)-2-(trifluoromethyl)phenoxy]-N-(cyanomethyl)acetamide |
| SMILES | N#CCNC(=O)COc1ccc(CN)cc1C(F)(F)F |
| InChI | InChI=1S/C12H12F3N3O2/c13-12(14,15)9-5-8(6-17)1-2-10(9)20-7-11(19)18-4-3-16/h1-2,5H,4,6-7,17H2,(H,18,19) |
| InChIKey | ANPXTNCCICSWDS-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|