C12H15F3N2O3S — CID 63320915
N-piperidin-3-yl-3-(trifluoromethoxy)benzenesulfonamide (PubChem CID 63320915) has the molecular formula C12H15F3N2O3S and a molecular weight of 324.32 g/mol. Its IUPAC name is N-piperidin-3-yl-3-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-piperidin-3-yl-3-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 63320915 |
| Molecular Formula | C12H15F3N2O3S |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | N-piperidin-3-yl-3-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(NC1CCCNC1)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F3N2O3S/c13-12(14,15)20-10-4-1-5-11(7-10)21(18,19)17-9-3-2-6-16-8-9/h1,4-5,7,9,16-17H,2-3,6,8H2 |
| InChIKey | LKRMXTUKDGUGLN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |