C29H47N2O+ — CID 6332201
imino-[4,4,10,13-tetramethyl-17-(6-methylheptan-2-yl)-3-oxo-1,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-ylidene]azanium (PubChem CID 6332201) has the molecular formula C29H47N2O+ and a molecular weight of 439.71 g/mol. Its IUPAC name is imino-[4,4,10,13-tetramethyl-17-(6-methylheptan-2-yl)-3-oxo-1,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-ylidene]azanium.
| Compound Name | imino-[4,4,10,13-tetramethyl-17-(6-methylheptan-2-yl)-3-oxo-1,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-ylidene]azanium |
|---|---|
| PubChem CID | 6332201 |
| Molecular Formula | C29H47N2O+ |
| Molecular Weight | 439.71 g/mol |
| Exact Mass | 439.37 |
| IUPAC Name | imino-[4,4,10,13-tetramethyl-17-(6-methylheptan-2-yl)-3-oxo-1,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-ylidene]azanium |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4C(C)(C)C(=O)C(=[N+]=N)CC4(C)C3CCC12C |
| InChI | InChI=1S/C29H47N2O/c1-18(2)9-8-10-19(3)21-12-13-22-20-11-14-25-27(4,5)26(32)24(31-30)17-29(25,7)23(20)15-16-28(21,22)6/h14,18-23,30H,8-13,15-17H2,1-7H3/q+1 |
| InChIKey | JPMQLGQIPDVRIL-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 55.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.71 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|