C15H24N3O3+ — CID 6332693
1-butyl-3-phenylpiperidin-2-imine;dihydroxy(oxo)azanium (PubChem CID 6332693) has the molecular formula C15H24N3O3+ and a molecular weight of 294.37 g/mol. Its IUPAC name is 1-butyl-3-phenylpiperidin-2-imine;dihydroxy(oxo)azanium.
| Compound Name | 1-butyl-3-phenylpiperidin-2-imine;dihydroxy(oxo)azanium |
|---|---|
| PubChem CID | 6332693 |
| Molecular Formula | C15H24N3O3+ |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 1-butyl-3-phenylpiperidin-2-imine;dihydroxy(oxo)azanium |
| SMILES | O=[N+](O)O.[H]/N=C1/C(c2ccccc2)CCCN1CCCC |
| InChI | InChI=1S/C15H22N2.H2NO3/c1-2-3-11-17-12-7-10-14(15(17)16)13-8-5-4-6-9-13;2-1(3)4/h4-6,8-9,14,16H,2-3,7,10-12H2,1H3;(H2,2,3,4)/q;+1/b16-15-; |
| InChIKey | CTXACKQALJBMFO-YFKNTREVSA-N |
| XLogP | 3.19 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|