C11H14FN5O2S — CID 63332713
2-amino-4-fluoro-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]benzenesulfonamide (PubChem CID 63332713) has the molecular formula C11H14FN5O2S and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-amino-4-fluoro-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]benzenesulfonamide.
| Compound Name | 2-amino-4-fluoro-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 63332713 |
| Molecular Formula | C11H14FN5O2S |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-amino-4-fluoro-N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]benzenesulfonamide |
| SMILES | Cn1cnnc1CCNS(=O)(=O)c1ccc(F)cc1N |
| InChI | InChI=1S/C11H14FN5O2S/c1-17-7-14-16-11(17)4-5-15-20(18,19)10-3-2-8(12)6-9(10)13/h2-3,6-7,15H,4-5,13H2,1H3 |
| InChIKey | ACSXJXRZORQFSH-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|