About N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidin-4-amine
N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidin-4-amine (PubChem CID 63332774) has the molecular formula C10H19N5
and a molecular weight of 209.30 g/mol. Its IUPAC name is N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidin-4-amine.
Molecular Properties
| Compound Name | N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidin-4-amine |
| PubChem CID | 63332774 |
| Molecular Formula | C10H19N5 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidin-4-amine |
| SMILES | Cn1cnnc1CCNC1CCNCC1 |
| InChI | InChI=1S/C10H19N5/c1-15-8-13-14-10(15)4-7-12-9-2-5-11-6-3-9/h8-9,11-12H,2-7H2,1H3 |
| InChIKey | RFNYZNOPLPOFFG-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidin-4-amine?
The IUPAC name of N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidin-4-amine (CID 63332774) is N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidin-4-amine.
What is the SMILES notation for N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidin-4-amine?
The canonical SMILES for N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidin-4-amine is Cn1cnnc1CCNC1CCNCC1.
What is the InChIKey of N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidin-4-amine?
The InChIKey is RFNYZNOPLPOFFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N5/c1-15-8-13-14-10(15)4-7-12-9-2-5-11-6-3-9/h8-9,11-12H,2-7H2,1H3.
What are the key properties of N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidin-4-amine?
N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidin-4-amine has a molecular weight of 209.30 g/mol, XLogP of -0.30, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]piperidin-4-amine is sourced from PubChem (CID 63332774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).