C11H20N4O — CID 65079206
N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]oxepan-4-amine (PubChem CID 65079206) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]oxepan-4-amine.
| Compound Name | N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]oxepan-4-amine |
|---|---|
| PubChem CID | 65079206 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]oxepan-4-amine |
| SMILES | Cn1cnnc1CCNC1CCCOCC1 |
| InChI | InChI=1S/C11H20N4O/c1-15-9-13-14-11(15)4-6-12-10-3-2-7-16-8-5-10/h9-10,12H,2-8H2,1H3 |
| InChIKey | FLSBAKFQISVAQE-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |