C14H16BrN3O2 — CID 63334289
1-(3-bromo-4-methylphenyl)-5-tert-butyltriazole-4-carboxylic acid (PubChem CID 63334289) has the molecular formula C14H16BrN3O2 and a molecular weight of 338.21 g/mol. Its IUPAC name is 1-(3-bromo-4-methylphenyl)-5-tert-butyltriazole-4-carboxylic acid.
| Compound Name | 1-(3-bromo-4-methylphenyl)-5-tert-butyltriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 63334289 |
| Molecular Formula | C14H16BrN3O2 |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 1-(3-bromo-4-methylphenyl)-5-tert-butyltriazole-4-carboxylic acid |
| SMILES | Cc1ccc(-n2nnc(C(=O)O)c2C(C)(C)C)cc1Br |
| InChI | InChI=1S/C14H16BrN3O2/c1-8-5-6-9(7-10(8)15)18-12(14(2,3)4)11(13(19)20)16-17-18/h5-7H,1-4H3,(H,19,20) |
| InChIKey | JCKVQWUTCHOSAV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |