C13H13F2N3O2 — CID 43173558
5-tert-butyl-1-(2,5-difluorophenyl)triazole-4-carboxylic acid (PubChem CID 43173558) has the molecular formula C13H13F2N3O2 and a molecular weight of 281.26 g/mol. Its IUPAC name is 5-tert-butyl-1-(2,5-difluorophenyl)triazole-4-carboxylic acid.
| Compound Name | 5-tert-butyl-1-(2,5-difluorophenyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 43173558 |
| Molecular Formula | C13H13F2N3O2 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 5-tert-butyl-1-(2,5-difluorophenyl)triazole-4-carboxylic acid |
| SMILES | CC(C)(C)c1c(C(=O)O)nnn1-c1cc(F)ccc1F |
| InChI | InChI=1S/C13H13F2N3O2/c1-13(2,3)11-10(12(19)20)16-17-18(11)9-6-7(14)4-5-8(9)15/h4-6H,1-3H3,(H,19,20) |
| InChIKey | WAUBMNHQHFTPPT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |