C11H8F2N2O2 — CID 105421480
1-(2,5-difluorophenyl)-5-methylpyrazole-3-carboxylic acid (PubChem CID 105421480) has the molecular formula C11H8F2N2O2 and a molecular weight of 238.19 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-5-methylpyrazole-3-carboxylic acid.
| Compound Name | 1-(2,5-difluorophenyl)-5-methylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 105421480 |
| Molecular Formula | C11H8F2N2O2 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 1-(2,5-difluorophenyl)-5-methylpyrazole-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)nn1-c1cc(F)ccc1F |
| InChI | InChI=1S/C11H8F2N2O2/c1-6-4-9(11(16)17)14-15(6)10-5-7(12)2-3-8(10)13/h2-5H,1H3,(H,16,17) |
| InChIKey | FFSKOKUXKBPYSY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |