C11H6F4N2O2 — CID 107645273
5-methyl-1-(2,3,5,6-tetrafluorophenyl)pyrazole-3-carboxylic acid (PubChem CID 107645273) has the molecular formula C11H6F4N2O2 and a molecular weight of 274.17 g/mol. Its IUPAC name is 5-methyl-1-(2,3,5,6-tetrafluorophenyl)pyrazole-3-carboxylic acid.
| Compound Name | 5-methyl-1-(2,3,5,6-tetrafluorophenyl)pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 107645273 |
| Molecular Formula | C11H6F4N2O2 |
| Molecular Weight | 274.17 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 5-methyl-1-(2,3,5,6-tetrafluorophenyl)pyrazole-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)nn1-c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C11H6F4N2O2/c1-4-2-7(11(18)19)16-17(4)10-8(14)5(12)3-6(13)9(10)15/h2-3H,1H3,(H,18,19) |
| InChIKey | UECMRGGJQHBTMF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.17 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|