C12H9F4N3O2 — CID 107645779
5-propyl-1-(2,3,5,6-tetrafluorophenyl)-1,2,4-triazole-3-carboxylic acid (PubChem CID 107645779) has the molecular formula C12H9F4N3O2 and a molecular weight of 303.22 g/mol. Its IUPAC name is 5-propyl-1-(2,3,5,6-tetrafluorophenyl)-1,2,4-triazole-3-carboxylic acid.
| Compound Name | 5-propyl-1-(2,3,5,6-tetrafluorophenyl)-1,2,4-triazole-3-carboxylic acid |
|---|---|
| PubChem CID | 107645779 |
| Molecular Formula | C12H9F4N3O2 |
| Molecular Weight | 303.22 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 5-propyl-1-(2,3,5,6-tetrafluorophenyl)-1,2,4-triazole-3-carboxylic acid |
| SMILES | CCCc1nc(C(=O)O)nn1-c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C12H9F4N3O2/c1-2-3-7-17-11(12(20)21)18-19(7)10-8(15)5(13)4-6(14)9(10)16/h4H,2-3H2,1H3,(H,20,21) |
| InChIKey | ZWDLQBCJTSEFAU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|