About 1-(4-fluorophenyl)-5-propyl-1,2,4-triazole-3-carboxylic acid
1-(4-fluorophenyl)-5-propyl-1,2,4-triazole-3-carboxylic acid (PubChem CID 43652436) has the molecular formula C12H12FN3O2
and a molecular weight of 249.25 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-propyl-1,2,4-triazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-(4-fluorophenyl)-5-propyl-1,2,4-triazole-3-carboxylic acid |
| PubChem CID | 43652436 |
| Molecular Formula | C12H12FN3O2 |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 1-(4-fluorophenyl)-5-propyl-1,2,4-triazole-3-carboxylic acid |
| SMILES | CCCc1nc(C(=O)O)nn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C12H12FN3O2/c1-2-3-10-14-11(12(17)18)15-16(10)9-6-4-8(13)5-7-9/h4-7H,2-3H2,1H3,(H,17,18) |
| InChIKey | ICSHFOIEUAPILP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-fluorophenyl)-5-propyl-1,2,4-triazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorophenyl)-5-propyl-1,2,4-triazole-3-carboxylic acid?
The IUPAC name of 1-(4-fluorophenyl)-5-propyl-1,2,4-triazole-3-carboxylic acid (CID 43652436) is 1-(4-fluorophenyl)-5-propyl-1,2,4-triazole-3-carboxylic acid.
What is the SMILES notation for 1-(4-fluorophenyl)-5-propyl-1,2,4-triazole-3-carboxylic acid?
The canonical SMILES for 1-(4-fluorophenyl)-5-propyl-1,2,4-triazole-3-carboxylic acid is CCCc1nc(C(=O)O)nn1-c1ccc(F)cc1.
What is the InChIKey of 1-(4-fluorophenyl)-5-propyl-1,2,4-triazole-3-carboxylic acid?
The InChIKey is ICSHFOIEUAPILP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FN3O2/c1-2-3-10-14-11(12(17)18)15-16(10)9-6-4-8(13)5-7-9/h4-7H,2-3H2,1H3,(H,17,18).
What are the key properties of 1-(4-fluorophenyl)-5-propyl-1,2,4-triazole-3-carboxylic acid?
1-(4-fluorophenyl)-5-propyl-1,2,4-triazole-3-carboxylic acid has a molecular weight of 249.25 g/mol, XLogP of 2.06, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorophenyl)-5-propyl-1,2,4-triazole-3-carboxylic acid is sourced from PubChem (CID 43652436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).