C12H12AlN3O2 — CID 58621195
CID 58621195 (PubChem CID 58621195) has the molecular formula C12H12AlN3O2 and a molecular weight of 257.23 g/mol.
| Compound Name | CID 58621195 |
|---|---|
| PubChem CID | 58621195 |
| Molecular Formula | C12H12AlN3O2 |
| Molecular Weight | 257.23 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | — |
| SMILES | CCCc1nc(C(=O)O[Al])nn1-c1ccccc1 |
| InChI | InChI=1S/C12H13N3O2.Al/c1-2-6-10-13-11(12(16)17)14-15(10)9-7-4-3-5-8-9;/h3-5,7-8H,2,6H2,1H3,(H,16,17);/q;+1/p-1 |
| InChIKey | JFWATCMRAVGESN-UHFFFAOYSA-M |
| XLogP | 1.46 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |