C32H30N4O — CID 42693071
N-benzyl-1-phenyl-N,5-bis(2-phenylethyl)-1,2,4-triazole-3-carboxamide (PubChem CID 42693071) has the molecular formula C32H30N4O and a molecular weight of 486.62 g/mol. Its IUPAC name is N-benzyl-1-phenyl-N,5-bis(2-phenylethyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | N-benzyl-1-phenyl-N,5-bis(2-phenylethyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 42693071 |
| Molecular Formula | C32H30N4O |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | N-benzyl-1-phenyl-N,5-bis(2-phenylethyl)-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(c1nc(CCc2ccccc2)n(-c2ccccc2)n1)N(CCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C32H30N4O/c37-32(35(25-28-17-9-3-10-18-28)24-23-27-15-7-2-8-16-27)31-33-30(22-21-26-13-5-1-6-14-26)36(34-31)29-19-11-4-12-20-29/h1-20H,21-25H2 |
| InChIKey | IJEYQYCTAVLNGY-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |