C25H24N4O — CID 42692840
5-benzyl-1-phenyl-N-(3-phenylpropyl)-1,2,4-triazole-3-carboxamide (PubChem CID 42692840) has the molecular formula C25H24N4O and a molecular weight of 396.49 g/mol. Its IUPAC name is 5-benzyl-1-phenyl-N-(3-phenylpropyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-benzyl-1-phenyl-N-(3-phenylpropyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 42692840 |
| Molecular Formula | C25H24N4O |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 5-benzyl-1-phenyl-N-(3-phenylpropyl)-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)c1nc(Cc2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H24N4O/c30-25(26-18-10-15-20-11-4-1-5-12-20)24-27-23(19-21-13-6-2-7-14-21)29(28-24)22-16-8-3-9-17-22/h1-9,11-14,16-17H,10,15,18-19H2,(H,26,30) |
| InChIKey | BUPONSSGYSGCSW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|