C20H18N4O — CID 42692876
5-benzyl-1-(4-methylphenyl)-N-prop-2-ynyl-1,2,4-triazole-3-carboxamide (PubChem CID 42692876) has the molecular formula C20H18N4O and a molecular weight of 330.39 g/mol. Its IUPAC name is 5-benzyl-1-(4-methylphenyl)-N-prop-2-ynyl-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-benzyl-1-(4-methylphenyl)-N-prop-2-ynyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 42692876 |
| Molecular Formula | C20H18N4O |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 5-benzyl-1-(4-methylphenyl)-N-prop-2-ynyl-1,2,4-triazole-3-carboxamide |
| SMILES | C#CCNC(=O)c1nc(Cc2ccccc2)n(-c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C20H18N4O/c1-3-13-21-20(25)19-22-18(14-16-7-5-4-6-8-16)24(23-19)17-11-9-15(2)10-12-17/h1,4-12H,13-14H2,2H3,(H,21,25) |
| InChIKey | JDVQKXUBDBEVQY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|