C24H31N5O3S — CID 59532288
5-benzyl-N-pentyl-N-propyl-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide (PubChem CID 59532288) has the molecular formula C24H31N5O3S and a molecular weight of 469.61 g/mol. Its IUPAC name is 5-benzyl-N-pentyl-N-propyl-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-benzyl-N-pentyl-N-propyl-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 59532288 |
| Molecular Formula | C24H31N5O3S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 5-benzyl-N-pentyl-N-propyl-1-(4-sulfamoylphenyl)-1,2,4-triazole-3-carboxamide |
| SMILES | CCCCCN(CCC)C(=O)c1nc(Cc2ccccc2)n(-c2ccc(S(N)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C24H31N5O3S/c1-3-5-9-17-28(16-4-2)24(30)23-26-22(18-19-10-7-6-8-11-19)29(27-23)20-12-14-21(15-13-20)33(25,31)32/h6-8,10-15H,3-5,9,16-18H2,1-2H3,(H2,25,31,32) |
| InChIKey | JOPYIUUMTKUWMT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|