C24H26N6O — CID 42881037
N-(3-imidazol-1-ylpropyl)-1-(3-methylphenyl)-5-(2-phenylethyl)-1,2,4-triazole-3-carboxamide (PubChem CID 42881037) has the molecular formula C24H26N6O and a molecular weight of 414.51 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-1-(3-methylphenyl)-5-(2-phenylethyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-1-(3-methylphenyl)-5-(2-phenylethyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 42881037 |
| Molecular Formula | C24H26N6O |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-1-(3-methylphenyl)-5-(2-phenylethyl)-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1cccc(-n2nc(C(=O)NCCCn3ccnc3)nc2CCc2ccccc2)c1 |
| InChI | InChI=1S/C24H26N6O/c1-19-7-5-10-21(17-19)30-22(12-11-20-8-3-2-4-9-20)27-23(28-30)24(31)26-13-6-15-29-16-14-25-18-29/h2-5,7-10,14,16-18H,6,11-13,15H2,1H3,(H,26,31) |
| InChIKey | AXTYEDZFYJYOQW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|