C24H22N4O2 — CID 78796020
N-benzyl-N-(2-hydroxyethyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide (PubChem CID 78796020) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is N-benzyl-N-(2-hydroxyethyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-benzyl-N-(2-hydroxyethyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 78796020 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | N-benzyl-N-(2-hydroxyethyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(c1nc(-c2ccccc2)n(-c2ccccc2)n1)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C24H22N4O2/c29-17-16-27(18-19-10-4-1-5-11-19)24(30)22-25-23(20-12-6-2-7-13-20)28(26-22)21-14-8-3-9-15-21/h1-15,29H,16-18H2 |
| InChIKey | MDCDEJFDZWPTAN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |