C19H20N4O2 — CID 110020225
N-benzyl-N-(2-hydroxyethyl)-4-(1-methyl-1,2,4-triazol-3-yl)benzamide (PubChem CID 110020225) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is N-benzyl-N-(2-hydroxyethyl)-4-(1-methyl-1,2,4-triazol-3-yl)benzamide.
| Compound Name | N-benzyl-N-(2-hydroxyethyl)-4-(1-methyl-1,2,4-triazol-3-yl)benzamide |
|---|---|
| PubChem CID | 110020225 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | N-benzyl-N-(2-hydroxyethyl)-4-(1-methyl-1,2,4-triazol-3-yl)benzamide |
| SMILES | Cn1cnc(-c2ccc(C(=O)N(CCO)Cc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C19H20N4O2/c1-22-14-20-18(21-22)16-7-9-17(10-8-16)19(25)23(11-12-24)13-15-5-3-2-4-6-15/h2-10,14,24H,11-13H2,1H3 |
| InChIKey | CGUGRJHRRMQKHP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |