C27H24N4O2 — CID 166209684
(3-cyano-3,3-diphenylpropyl) 5-ethyl-1-phenyl-1,2,4-triazole-3-carboxylate (PubChem CID 166209684) has the molecular formula C27H24N4O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is (3-cyano-3,3-diphenylpropyl) 5-ethyl-1-phenyl-1,2,4-triazole-3-carboxylate.
| Compound Name | (3-cyano-3,3-diphenylpropyl) 5-ethyl-1-phenyl-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 166209684 |
| Molecular Formula | C27H24N4O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | (3-cyano-3,3-diphenylpropyl) 5-ethyl-1-phenyl-1,2,4-triazole-3-carboxylate |
| SMILES | CCc1nc(C(=O)OCCC(C#N)(c2ccccc2)c2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C27H24N4O2/c1-2-24-29-25(30-31(24)23-16-10-5-11-17-23)26(32)33-19-18-27(20-28,21-12-6-3-7-13-21)22-14-8-4-9-15-22/h3-17H,2,18-19H2,1H3 |
| InChIKey | UTBIBOUDMNQSJT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 80.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |