C17H22N4O3 — CID 120614235
(2S)-2-[(5-ethyl-1-phenyl-1,2,4-triazole-3-carbonyl)amino]hexanoic acid (PubChem CID 120614235) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is (2S)-2-[(5-ethyl-1-phenyl-1,2,4-triazole-3-carbonyl)amino]hexanoic acid.
| Compound Name | (2S)-2-[(5-ethyl-1-phenyl-1,2,4-triazole-3-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 120614235 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (2S)-2-[(5-ethyl-1-phenyl-1,2,4-triazole-3-carbonyl)amino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)c1nc(CC)n(-c2ccccc2)n1)C(=O)O |
| InChI | InChI=1S/C17H22N4O3/c1-3-5-11-13(17(23)24)18-16(22)15-19-14(4-2)21(20-15)12-9-7-6-8-10-12/h6-10,13H,3-5,11H2,1-2H3,(H,18,22)(H,23,24)/t13-/m0/s1 |
| InChIKey | LVZCMPZAMNSTSD-ZDUSSCGKSA-N |
| XLogP | 2.20 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |