C17H24N6O3 — CID 120615255
(2S)-2-[2-[(1-phenyltetrazol-5-yl)amino]butanoylamino]hexanoic acid (PubChem CID 120615255) has the molecular formula C17H24N6O3 and a molecular weight of 360.42 g/mol. Its IUPAC name is (2S)-2-[2-[(1-phenyltetrazol-5-yl)amino]butanoylamino]hexanoic acid.
| Compound Name | (2S)-2-[2-[(1-phenyltetrazol-5-yl)amino]butanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 120615255 |
| Molecular Formula | C17H24N6O3 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | (2S)-2-[2-[(1-phenyltetrazol-5-yl)amino]butanoylamino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)C(CC)Nc1nnnn1-c1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H24N6O3/c1-3-5-11-14(16(25)26)18-15(24)13(4-2)19-17-20-21-22-23(17)12-9-7-6-8-10-12/h6-10,13-14H,3-5,11H2,1-2H3,(H,18,24)(H,25,26)(H,19,20,22)/t13?,14-/m0/s1 |
| InChIKey | XFGHNIQARQPGPA-KZUDCZAMSA-N |
| XLogP | 1.61 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |