C16H20N8O — CID 95331748
(2R)-N-(1-ethylpyrazol-4-yl)-2-[(1-phenyltetrazol-5-yl)amino]butanamide (PubChem CID 95331748) has the molecular formula C16H20N8O and a molecular weight of 340.39 g/mol. Its IUPAC name is (2R)-N-(1-ethylpyrazol-4-yl)-2-[(1-phenyltetrazol-5-yl)amino]butanamide.
| Compound Name | (2R)-N-(1-ethylpyrazol-4-yl)-2-[(1-phenyltetrazol-5-yl)amino]butanamide |
|---|---|
| PubChem CID | 95331748 |
| Molecular Formula | C16H20N8O |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | (2R)-N-(1-ethylpyrazol-4-yl)-2-[(1-phenyltetrazol-5-yl)amino]butanamide |
| SMILES | CC[C@@H](Nc1nnnn1-c1ccccc1)C(=O)Nc1cnn(CC)c1 |
| InChI | InChI=1S/C16H20N8O/c1-3-14(15(25)18-12-10-17-23(4-2)11-12)19-16-20-21-22-24(16)13-8-6-5-7-9-13/h5-11,14H,3-4H2,1-2H3,(H,18,25)(H,19,20,22)/t14-/m1/s1 |
| InChIKey | WBQSUFLCEPZXEA-CQSZACIVSA-N |
| XLogP | 1.71 |
| TPSA | 102.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |