C15H20N6O3 — CID 119362556
3-[methyl-[2-[(1-phenyltetrazol-5-yl)amino]butanoyl]amino]propanoic acid (PubChem CID 119362556) has the molecular formula C15H20N6O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is 3-[methyl-[2-[(1-phenyltetrazol-5-yl)amino]butanoyl]amino]propanoic acid.
| Compound Name | 3-[methyl-[2-[(1-phenyltetrazol-5-yl)amino]butanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119362556 |
| Molecular Formula | C15H20N6O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 3-[methyl-[2-[(1-phenyltetrazol-5-yl)amino]butanoyl]amino]propanoic acid |
| SMILES | CCC(Nc1nnnn1-c1ccccc1)C(=O)N(C)CCC(=O)O |
| InChI | InChI=1S/C15H20N6O3/c1-3-12(14(24)20(2)10-9-13(22)23)16-15-17-18-19-21(15)11-7-5-4-6-8-11/h4-8,12H,3,9-10H2,1-2H3,(H,22,23)(H,16,17,19) |
| InChIKey | BPCDMYFPONYTJC-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |