C17H23N5O3 — CID 120614831
(2S)-2-[[2-(5-methyltetrazol-1-yl)-3-phenylpropanoyl]amino]hexanoic acid (PubChem CID 120614831) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is (2S)-2-[[2-(5-methyltetrazol-1-yl)-3-phenylpropanoyl]amino]hexanoic acid.
| Compound Name | (2S)-2-[[2-(5-methyltetrazol-1-yl)-3-phenylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 120614831 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | (2S)-2-[[2-(5-methyltetrazol-1-yl)-3-phenylpropanoyl]amino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)C(Cc1ccccc1)n1nnnc1C)C(=O)O |
| InChI | InChI=1S/C17H23N5O3/c1-3-4-10-14(17(24)25)18-16(23)15(22-12(2)19-20-21-22)11-13-8-6-5-7-9-13/h5-9,14-15H,3-4,10-11H2,1-2H3,(H,18,23)(H,24,25)/t14-,15?/m0/s1 |
| InChIKey | WQXNAPQLQOWAKL-MLCCFXAWSA-N |
| XLogP | 1.52 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |