C17H27ClN6O — CID 119642838
N-(2-amino-2-ethylbutyl)-2-(5-methyltetrazol-1-yl)-3-phenylpropanamide;hydrochloride (PubChem CID 119642838) has the molecular formula C17H27ClN6O and a molecular weight of 366.90 g/mol. Its IUPAC name is N-(2-amino-2-ethylbutyl)-2-(5-methyltetrazol-1-yl)-3-phenylpropanamide;hydrochloride.
| Compound Name | N-(2-amino-2-ethylbutyl)-2-(5-methyltetrazol-1-yl)-3-phenylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119642838 |
| Molecular Formula | C17H27ClN6O |
| Molecular Weight | 366.90 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | N-(2-amino-2-ethylbutyl)-2-(5-methyltetrazol-1-yl)-3-phenylpropanamide;hydrochloride |
| SMILES | CCC(N)(CC)CNC(=O)C(Cc1ccccc1)n1nnnc1C.Cl |
| InChI | InChI=1S/C17H26N6O.ClH/c1-4-17(18,5-2)12-19-16(24)15(23-13(3)20-21-22-23)11-14-9-7-6-8-10-14;/h6-10,15H,4-5,11-12,18H2,1-3H3,(H,19,24);1H |
| InChIKey | BZTUHGNREVDQNT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.90 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |