C15H17Cl2N3O — CID 63337858
2-[4-(2,6-dichlorobenzoyl)piperazin-1-yl]butanenitrile (PubChem CID 63337858) has the molecular formula C15H17Cl2N3O and a molecular weight of 326.23 g/mol. Its IUPAC name is 2-[4-(2,6-dichlorobenzoyl)piperazin-1-yl]butanenitrile.
| Compound Name | 2-[4-(2,6-dichlorobenzoyl)piperazin-1-yl]butanenitrile |
|---|---|
| PubChem CID | 63337858 |
| Molecular Formula | C15H17Cl2N3O |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 2-[4-(2,6-dichlorobenzoyl)piperazin-1-yl]butanenitrile |
| SMILES | CCC(C#N)N1CCN(C(=O)c2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C15H17Cl2N3O/c1-2-11(10-18)19-6-8-20(9-7-19)15(21)14-12(16)4-3-5-13(14)17/h3-5,11H,2,6-9H2,1H3 |
| InChIKey | VWZKQCIGJPJLQL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |