C15H17Br2N3O — CID 114369478
2-[4-(2,5-dibromobenzoyl)piperazin-1-yl]butanenitrile (PubChem CID 114369478) has the molecular formula C15H17Br2N3O and a molecular weight of 415.13 g/mol. Its IUPAC name is 2-[4-(2,5-dibromobenzoyl)piperazin-1-yl]butanenitrile.
| Compound Name | 2-[4-(2,5-dibromobenzoyl)piperazin-1-yl]butanenitrile |
|---|---|
| PubChem CID | 114369478 |
| Molecular Formula | C15H17Br2N3O |
| Molecular Weight | 415.13 g/mol |
| Exact Mass | 412.97 |
| IUPAC Name | 2-[4-(2,5-dibromobenzoyl)piperazin-1-yl]butanenitrile |
| SMILES | CCC(C#N)N1CCN(C(=O)c2cc(Br)ccc2Br)CC1 |
| InChI | InChI=1S/C15H17Br2N3O/c1-2-12(10-18)19-5-7-20(8-6-19)15(21)13-9-11(16)3-4-14(13)17/h3-4,9,12H,2,5-8H2,1H3 |
| InChIKey | ZWPGNNWNAZIPFK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.13 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |