2-[4-(2,5-dibromobenzoyl)piperazin-1-yl]propanoic acid

C14H16Br2N2O3 — CID 114367989

IUPAC2-[4-(2,5-dibromobenzoyl)piperazin-1-yl]propanoic acid
SMILESCC(C(=O)O)N1CCN(C(=O)c2cc(Br)ccc2Br)CC1
InChIInChI=1S/C14H16Br2N2O3/c1-9(14(20)21)17-4-6-18(7-5-17)13(19)11-8-10(15)2-3-12(11)16/h2-3,8-9H,4-7H2,1H3,(H,20,21)
InChIKeyMEWBHPVRYPKCOH-UHFFFAOYSA-N
MW420.10 g/mol
LogP2.44
Rot. Bonds3

About 2-[4-(2,5-dibromobenzoyl)piperazin-1-yl]propanoic acid

2-[4-(2,5-dibromobenzoyl)piperazin-1-yl]propanoic acid (PubChem CID 114367989) has the molecular formula C14H16Br2N2O3 and a molecular weight of 420.10 g/mol. Its IUPAC name is 2-[4-(2,5-dibromobenzoyl)piperazin-1-yl]propanoic acid.

Molecular Properties

Compound Name2-[4-(2,5-dibromobenzoyl)piperazin-1-yl]propanoic acid
PubChem CID114367989
Molecular FormulaC14H16Br2N2O3
Molecular Weight420.10 g/mol
Exact Mass417.95
IUPAC Name2-[4-(2,5-dibromobenzoyl)piperazin-1-yl]propanoic acid
SMILESCC(C(=O)O)N1CCN(C(=O)c2cc(Br)ccc2Br)CC1
InChIInChI=1S/C14H16Br2N2O3/c1-9(14(20)21)17-4-6-18(7-5-17)13(19)11-8-10(15)2-3-12(11)16/h2-3,8-9H,4-7H2,1H3,(H,20,21)
InChIKeyMEWBHPVRYPKCOH-UHFFFAOYSA-N
XLogP2.44
TPSA60.85 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500420.10
LogP ≤ 52.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[4-(2,5-dibromobenzoyl)piperazin-1-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[4-(5-bromo-2-fluorobenzoyl)piperazin-1-yl]propanoic acid
CID 62317604
(2,5-dibromophenyl)-[4-(2-methylpropyl)piperazin-1-yl]methanone
CID 114371674
2-[4-(3,5-dibromobenzoyl)piperazin-1-yl]propanoic acid
CID 107971361
(2-bromo-5-iodophenyl)-(4-propan-2-ylpiperazin-1-yl)methanone
CID 103994516
2-[4-(2,5-dibromobenzoyl)piperazin-1-yl]butanenitrile
CID 114369478
(2,5-dibromophenyl)-(4-methylsulfanylpiperidin-1-yl)methanone
CID 114237331
(4-bromo-2-fluorophenyl)-(4-propan-2-ylpiperazin-1-yl)methanone
CID 43420911
2-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]propanoic acid
CID 62317244
2-[4-(2-fluoro-5-methylbenzoyl)piperazin-1-yl]propanoic acid
CID 62516519
(5-bromo-2-hydroxyphenyl)-(4-butan-2-ylpiperazin-1-yl)methanone
CID 107729738
2-[4-(3-bromopyridine-2-carbonyl)piperazin-1-yl]propanoic acid
CID 107517070
2-[4-(5-bromo-2-fluorobenzoyl)piperazin-1-yl]-N-cyclopropylpropanamide
CID 51299634

Frequently Asked Questions

What is the IUPAC name of 2-[4-(2,5-dibromobenzoyl)piperazin-1-yl]propanoic acid?
The IUPAC name of 2-[4-(2,5-dibromobenzoyl)piperazin-1-yl]propanoic acid (CID 114367989) is 2-[4-(2,5-dibromobenzoyl)piperazin-1-yl]propanoic acid.
What is the SMILES notation for 2-[4-(2,5-dibromobenzoyl)piperazin-1-yl]propanoic acid?
The canonical SMILES for 2-[4-(2,5-dibromobenzoyl)piperazin-1-yl]propanoic acid is CC(C(=O)O)N1CCN(C(=O)c2cc(Br)ccc2Br)CC1.
What is the InChIKey of 2-[4-(2,5-dibromobenzoyl)piperazin-1-yl]propanoic acid?
The InChIKey is MEWBHPVRYPKCOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16Br2N2O3/c1-9(14(20)21)17-4-6-18(7-5-17)13(19)11-8-10(15)2-3-12(11)16/h2-3,8-9H,4-7H2,1H3,(H,20,21).
What are the key properties of 2-[4-(2,5-dibromobenzoyl)piperazin-1-yl]propanoic acid?
2-[4-(2,5-dibromobenzoyl)piperazin-1-yl]propanoic acid has a molecular weight of 420.10 g/mol, XLogP of 2.44, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,5-dibromobenzoyl)piperazin-1-yl]propanoic acid is sourced from PubChem (CID 114367989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).