C15H20Br2N2O — CID 114371674
(2,5-dibromophenyl)-[4-(2-methylpropyl)piperazin-1-yl]methanone (PubChem CID 114371674) has the molecular formula C15H20Br2N2O and a molecular weight of 404.15 g/mol. Its IUPAC name is (2,5-dibromophenyl)-[4-(2-methylpropyl)piperazin-1-yl]methanone.
| Compound Name | (2,5-dibromophenyl)-[4-(2-methylpropyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 114371674 |
| Molecular Formula | C15H20Br2N2O |
| Molecular Weight | 404.15 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | (2,5-dibromophenyl)-[4-(2-methylpropyl)piperazin-1-yl]methanone |
| SMILES | CC(C)CN1CCN(C(=O)c2cc(Br)ccc2Br)CC1 |
| InChI | InChI=1S/C15H20Br2N2O/c1-11(2)10-18-5-7-19(8-6-18)15(20)13-9-12(16)3-4-14(13)17/h3-4,9,11H,5-8,10H2,1-2H3 |
| InChIKey | AIJRMJJZRBFDSD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.15 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |