C13H15Br2NOS — CID 114237331
(2,5-dibromophenyl)-(4-methylsulfanylpiperidin-1-yl)methanone (PubChem CID 114237331) has the molecular formula C13H15Br2NOS and a molecular weight of 393.14 g/mol. Its IUPAC name is (2,5-dibromophenyl)-(4-methylsulfanylpiperidin-1-yl)methanone.
| Compound Name | (2,5-dibromophenyl)-(4-methylsulfanylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 114237331 |
| Molecular Formula | C13H15Br2NOS |
| Molecular Weight | 393.14 g/mol |
| Exact Mass | 390.92 |
| IUPAC Name | (2,5-dibromophenyl)-(4-methylsulfanylpiperidin-1-yl)methanone |
| SMILES | CSC1CCN(C(=O)c2cc(Br)ccc2Br)CC1 |
| InChI | InChI=1S/C13H15Br2NOS/c1-18-10-4-6-16(7-5-10)13(17)11-8-9(14)2-3-12(11)15/h2-3,8,10H,4-7H2,1H3 |
| InChIKey | HQBOOFOWXSANDC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.14 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |