C13H15Br2NO3 — CID 103533835
(2,5-dibromophenyl)-(3,4-dimethoxypyrrolidin-1-yl)methanone (PubChem CID 103533835) has the molecular formula C13H15Br2NO3 and a molecular weight of 393.08 g/mol. Its IUPAC name is (2,5-dibromophenyl)-(3,4-dimethoxypyrrolidin-1-yl)methanone.
| Compound Name | (2,5-dibromophenyl)-(3,4-dimethoxypyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 103533835 |
| Molecular Formula | C13H15Br2NO3 |
| Molecular Weight | 393.08 g/mol |
| Exact Mass | 390.94 |
| IUPAC Name | (2,5-dibromophenyl)-(3,4-dimethoxypyrrolidin-1-yl)methanone |
| SMILES | COC1CN(C(=O)c2cc(Br)ccc2Br)CC1OC |
| InChI | InChI=1S/C13H15Br2NO3/c1-18-11-6-16(7-12(11)19-2)13(17)9-5-8(14)3-4-10(9)15/h3-5,11-12H,6-7H2,1-2H3 |
| InChIKey | SUDJEGFZKVWXBS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.08 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |