C12H10N6O2 — CID 63338330
6-[4-(3-aminophenyl)pyrazol-1-yl]-2H-1,2,4-triazine-3,5-dione (PubChem CID 63338330) has the molecular formula C12H10N6O2 and a molecular weight of 270.25 g/mol. Its IUPAC name is 6-[4-(3-aminophenyl)pyrazol-1-yl]-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[4-(3-aminophenyl)pyrazol-1-yl]-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 63338330 |
| Molecular Formula | C12H10N6O2 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 6-[4-(3-aminophenyl)pyrazol-1-yl]-2H-1,2,4-triazine-3,5-dione |
| SMILES | Nc1cccc(-c2cnn(-c3n[nH]c(=O)[nH]c3=O)c2)c1 |
| InChI | InChI=1S/C12H10N6O2/c13-9-3-1-2-7(4-9)8-5-14-18(6-8)10-11(19)15-12(20)17-16-10/h1-6H,13H2,(H2,15,17,19,20) |
| InChIKey | CAAFJLZCKRMKEH-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|