C14H29N5O2 — CID 63340073
2-[4-(1-aminopentan-2-yl)piperazin-1-yl]-N-(methylcarbamoyl)propanamide (PubChem CID 63340073) has the molecular formula C14H29N5O2 and a molecular weight of 299.42 g/mol. Its IUPAC name is 2-[4-(1-aminopentan-2-yl)piperazin-1-yl]-N-(methylcarbamoyl)propanamide.
| Compound Name | 2-[4-(1-aminopentan-2-yl)piperazin-1-yl]-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 63340073 |
| Molecular Formula | C14H29N5O2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.23 |
| IUPAC Name | 2-[4-(1-aminopentan-2-yl)piperazin-1-yl]-N-(methylcarbamoyl)propanamide |
| SMILES | CCCC(CN)N1CCN(C(C)C(=O)NC(=O)NC)CC1 |
| InChI | InChI=1S/C14H29N5O2/c1-4-5-12(10-15)19-8-6-18(7-9-19)11(2)13(20)17-14(21)16-3/h11-12H,4-10,15H2,1-3H3,(H2,16,17,20,21) |
| InChIKey | RWRCQKGWLXYVEZ-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |