C12H21N5O2 — CID 63341284
2-[4-(1-cyanoethyl)piperazin-1-yl]-N-(methylcarbamoyl)propanamide (PubChem CID 63341284) has the molecular formula C12H21N5O2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-[4-(1-cyanoethyl)piperazin-1-yl]-N-(methylcarbamoyl)propanamide.
| Compound Name | 2-[4-(1-cyanoethyl)piperazin-1-yl]-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 63341284 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 2-[4-(1-cyanoethyl)piperazin-1-yl]-N-(methylcarbamoyl)propanamide |
| SMILES | CNC(=O)NC(=O)C(C)N1CCN(C(C)C#N)CC1 |
| InChI | InChI=1S/C12H21N5O2/c1-9(8-13)16-4-6-17(7-5-16)10(2)11(18)15-12(19)14-3/h9-10H,4-7H2,1-3H3,(H2,14,15,18,19) |
| InChIKey | RBJAODLTOSFRIY-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |