C16H34N4O — CID 63343532
2-[4-(1-aminopentan-2-yl)piperazin-1-yl]-N-(3-methylbutan-2-yl)acetamide (PubChem CID 63343532) has the molecular formula C16H34N4O and a molecular weight of 298.47 g/mol. Its IUPAC name is 2-[4-(1-aminopentan-2-yl)piperazin-1-yl]-N-(3-methylbutan-2-yl)acetamide.
| Compound Name | 2-[4-(1-aminopentan-2-yl)piperazin-1-yl]-N-(3-methylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 63343532 |
| Molecular Formula | C16H34N4O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | 2-[4-(1-aminopentan-2-yl)piperazin-1-yl]-N-(3-methylbutan-2-yl)acetamide |
| SMILES | CCCC(CN)N1CCN(CC(=O)NC(C)C(C)C)CC1 |
| InChI | InChI=1S/C16H34N4O/c1-5-6-15(11-17)20-9-7-19(8-10-20)12-16(21)18-14(4)13(2)3/h13-15H,5-12,17H2,1-4H3,(H,18,21) |
| InChIKey | PVJVWVYTRJVKIL-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |