C17H16N2O2 — CID 63344511
1-(3-naphthalen-1-yl-1,2,4-oxadiazol-5-yl)pentan-2-one (PubChem CID 63344511) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 1-(3-naphthalen-1-yl-1,2,4-oxadiazol-5-yl)pentan-2-one.
| Compound Name | 1-(3-naphthalen-1-yl-1,2,4-oxadiazol-5-yl)pentan-2-one |
|---|---|
| PubChem CID | 63344511 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 1-(3-naphthalen-1-yl-1,2,4-oxadiazol-5-yl)pentan-2-one |
| SMILES | CCCC(=O)Cc1nc(-c2cccc3ccccc23)no1 |
| InChI | InChI=1S/C17H16N2O2/c1-2-6-13(20)11-16-18-17(19-21-16)15-10-5-8-12-7-3-4-9-14(12)15/h3-5,7-10H,2,6,11H2,1H3 |
| InChIKey | ZAORUBUZWPBHLD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |