C11H16N2O2 — CID 63345470
1-[3-(4-methylcyclohexyl)-1,2,4-oxadiazol-5-yl]ethanone (PubChem CID 63345470) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 1-[3-(4-methylcyclohexyl)-1,2,4-oxadiazol-5-yl]ethanone.
| Compound Name | 1-[3-(4-methylcyclohexyl)-1,2,4-oxadiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 63345470 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 1-[3-(4-methylcyclohexyl)-1,2,4-oxadiazol-5-yl]ethanone |
| SMILES | CC(=O)c1nc(C2CCC(C)CC2)no1 |
| InChI | InChI=1S/C11H16N2O2/c1-7-3-5-9(6-4-7)10-12-11(8(2)14)15-13-10/h7,9H,3-6H2,1-2H3 |
| InChIKey | PQWOATFXSJJYJH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |