About 1-(3-benzhydryl-1,2,4-oxadiazol-5-yl)ethanol
1-(3-benzhydryl-1,2,4-oxadiazol-5-yl)ethanol (PubChem CID 63346229) has the molecular formula C17H16N2O2
and a molecular weight of 280.33 g/mol. Its IUPAC name is 1-(3-benzhydryl-1,2,4-oxadiazol-5-yl)ethanol.
Molecular Properties
| Compound Name | 1-(3-benzhydryl-1,2,4-oxadiazol-5-yl)ethanol |
| PubChem CID | 63346229 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 1-(3-benzhydryl-1,2,4-oxadiazol-5-yl)ethanol |
| SMILES | CC(O)c1nc(C(c2ccccc2)c2ccccc2)no1 |
| InChI | InChI=1S/C17H16N2O2/c1-12(20)17-18-16(19-21-17)15(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-12,15,20H,1H3 |
| InChIKey | RVCCVEKAZOBAQR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-benzhydryl-1,2,4-oxadiazol-5-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-benzhydryl-1,2,4-oxadiazol-5-yl)ethanol?
The IUPAC name of 1-(3-benzhydryl-1,2,4-oxadiazol-5-yl)ethanol (CID 63346229) is 1-(3-benzhydryl-1,2,4-oxadiazol-5-yl)ethanol.
What is the SMILES notation for 1-(3-benzhydryl-1,2,4-oxadiazol-5-yl)ethanol?
The canonical SMILES for 1-(3-benzhydryl-1,2,4-oxadiazol-5-yl)ethanol is CC(O)c1nc(C(c2ccccc2)c2ccccc2)no1.
What is the InChIKey of 1-(3-benzhydryl-1,2,4-oxadiazol-5-yl)ethanol?
The InChIKey is RVCCVEKAZOBAQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O2/c1-12(20)17-18-16(19-21-17)15(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-12,15,20H,1H3.
What are the key properties of 1-(3-benzhydryl-1,2,4-oxadiazol-5-yl)ethanol?
1-(3-benzhydryl-1,2,4-oxadiazol-5-yl)ethanol has a molecular weight of 280.33 g/mol, XLogP of 3.30, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-benzhydryl-1,2,4-oxadiazol-5-yl)ethanol is sourced from PubChem (CID 63346229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).