C13H16F3NO2 — CID 63360178
N-[[2-(trifluoromethoxy)phenyl]methyl]oxan-3-amine (PubChem CID 63360178) has the molecular formula C13H16F3NO2 and a molecular weight of 275.27 g/mol. Its IUPAC name is N-[[2-(trifluoromethoxy)phenyl]methyl]oxan-3-amine.
| Compound Name | N-[[2-(trifluoromethoxy)phenyl]methyl]oxan-3-amine |
|---|---|
| PubChem CID | 63360178 |
| Molecular Formula | C13H16F3NO2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | N-[[2-(trifluoromethoxy)phenyl]methyl]oxan-3-amine |
| SMILES | FC(F)(F)Oc1ccccc1CNC1CCCOC1 |
| InChI | InChI=1S/C13H16F3NO2/c14-13(15,16)19-12-6-2-1-4-10(12)8-17-11-5-3-7-18-9-11/h1-2,4,6,11,17H,3,5,7-9H2 |
| InChIKey | KSXCODMGBXALLK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |