C13H14F2N2O2 — CID 63362058
4-(3,4-difluorobenzoyl)-3,3-dimethylpiperazin-2-one (PubChem CID 63362058) has the molecular formula C13H14F2N2O2 and a molecular weight of 268.26 g/mol. Its IUPAC name is 4-(3,4-difluorobenzoyl)-3,3-dimethylpiperazin-2-one.
| Compound Name | 4-(3,4-difluorobenzoyl)-3,3-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 63362058 |
| Molecular Formula | C13H14F2N2O2 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 4-(3,4-difluorobenzoyl)-3,3-dimethylpiperazin-2-one |
| SMILES | CC1(C)C(=O)NCCN1C(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H14F2N2O2/c1-13(2)12(19)16-5-6-17(13)11(18)8-3-4-9(14)10(15)7-8/h3-4,7H,5-6H2,1-2H3,(H,16,19) |
| InChIKey | HXRQBLYJOHHOPD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |