C15H23N3O3 — CID 63363227
N-[(2,4-dimethoxyphenyl)methyl]-5-methylpiperazine-2-carboxamide (PubChem CID 63363227) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-5-methylpiperazine-2-carboxamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-5-methylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 63363227 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-5-methylpiperazine-2-carboxamide |
| SMILES | COc1ccc(CNC(=O)C2CNC(C)CN2)c(OC)c1 |
| InChI | InChI=1S/C15H23N3O3/c1-10-7-17-13(9-16-10)15(19)18-8-11-4-5-12(20-2)6-14(11)21-3/h4-6,10,13,16-17H,7-9H2,1-3H3,(H,18,19) |
| InChIKey | NAKUWFNVHMEOGB-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |