C17H16N2O2 — CID 63365341
(1S)-1-[1-(pyrimidin-2-ylmethoxy)naphthalen-2-yl]ethanol (PubChem CID 63365341) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is (1S)-1-[1-(pyrimidin-2-ylmethoxy)naphthalen-2-yl]ethanol.
| Compound Name | (1S)-1-[1-(pyrimidin-2-ylmethoxy)naphthalen-2-yl]ethanol |
|---|---|
| PubChem CID | 63365341 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | (1S)-1-[1-(pyrimidin-2-ylmethoxy)naphthalen-2-yl]ethanol |
| SMILES | C[C@H](O)c1ccc2ccccc2c1OCc1ncccn1 |
| InChI | InChI=1S/C17H16N2O2/c1-12(20)14-8-7-13-5-2-3-6-15(13)17(14)21-11-16-18-9-4-10-19-16/h2-10,12,20H,11H2,1H3/t12-/m0/s1 |
| InChIKey | NLOCRYIAUIZZBY-LBPRGKRZSA-N |
| XLogP | 3.26 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |