C17H22O2 — CID 63365584
(1R)-1-[1-(2-methylbutoxy)naphthalen-2-yl]ethanol (PubChem CID 63365584) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is (1R)-1-[1-(2-methylbutoxy)naphthalen-2-yl]ethanol.
| Compound Name | (1R)-1-[1-(2-methylbutoxy)naphthalen-2-yl]ethanol |
|---|---|
| PubChem CID | 63365584 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | (1R)-1-[1-(2-methylbutoxy)naphthalen-2-yl]ethanol |
| SMILES | CCC(C)COc1c([C@@H](C)O)ccc2ccccc12 |
| InChI | InChI=1S/C17H22O2/c1-4-12(2)11-19-17-15(13(3)18)10-9-14-7-5-6-8-16(14)17/h5-10,12-13,18H,4,11H2,1-3H3/t12?,13-/m1/s1 |
| InChIKey | ALKCFZGIZCPFLA-ZGTCLIOFSA-N |
| XLogP | 4.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |