C12H18BrNO2 — CID 63371869
1-[2-bromo-4-[(1R)-1-hydroxyethyl]-N-methylanilino]propan-2-ol (PubChem CID 63371869) has the molecular formula C12H18BrNO2 and a molecular weight of 288.19 g/mol. Its IUPAC name is 1-[2-bromo-4-[(1R)-1-hydroxyethyl]-N-methylanilino]propan-2-ol.
| Compound Name | 1-[2-bromo-4-[(1R)-1-hydroxyethyl]-N-methylanilino]propan-2-ol |
|---|---|
| PubChem CID | 63371869 |
| Molecular Formula | C12H18BrNO2 |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 1-[2-bromo-4-[(1R)-1-hydroxyethyl]-N-methylanilino]propan-2-ol |
| SMILES | CC(O)CN(C)c1ccc([C@@H](C)O)cc1Br |
| InChI | InChI=1S/C12H18BrNO2/c1-8(15)7-14(3)12-5-4-10(9(2)16)6-11(12)13/h4-6,8-9,15-16H,7H2,1-3H3/t8?,9-/m1/s1 |
| InChIKey | HIGJUSCBWGEJHA-YGPZHTELSA-N |
| XLogP | 2.32 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|